260-94-6 Acridine
| Nome do produto |
Acridine |
| Nome em inglês |
Acridine; Dibenzo[b,e]pyridine |
| Fórmula molecular |
C13H9N |
| Peso Molecular |
179.2173 |
| InChI |
InChI=1/C13H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H |
| CAS Registry Number |
260-94-6 |
| EINECS |
205-971-6 |
| Estrutura Molecular |
|
| Densidade |
1.187g/cm3 |
| Ponto de fus?o |
105-110℃ |
| Ponto de ebuli??o |
346.7°C at 760 mmHg |
| índice de refra??o |
1.726 |
| O ponto de inflama??o |
153.8°C |
| Press?o de vapor |
0.000113mmHg at 25°C |
| Símbolos de perigo |
Xn:Harmful;
|
| Códigos de risco |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|