2362-64-3 4-Methoxythiobenzamide
| Nome do produto |
4-Methoxythiobenzamide |
| Nome em inglês |
4-Methoxythiobenzamide;Benzenecarbothioamide, 4-methoxy-; Thio-p-anisamide; 4-methoxybenzenecarbothioamide |
| Fórmula molecular |
C8H9NOS |
| Peso Molecular |
167.2282 |
| InChI |
InChI=1/C8H9NOS/c1-10-7-4-2-6(3-5-7)8(9)11/h2-5H,1H3,(H2,9,11) |
| CAS Registry Number |
2362-64-3 |
| Estrutura Molecular |
|
| Densidade |
1.194g/cm3 |
| Ponto de ebuli??o |
288.5°C at 760 mmHg |
| índice de refra??o |
1.619 |
| O ponto de inflama??o |
128.3°C |
| Press?o de vapor |
0.00233mmHg at 25°C |
| Códigos de risco |
R20/22:Harmful by inhalation and if swallowed.;
|
| Descri??o da Seguran?a |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|