2307-10-0 S-n-Propyl thioacetate
| Nome do produto |
S-n-Propyl thioacetate |
| Nome em inglês |
S-n-Propyl thioacetate; Thioacetic acid S-n-propyl ester; S-propyl ethanethioate; Propyl thioacetate; Normal-propyl thioacetate |
| Fórmula molecular |
C5H10OS |
| Peso Molecular |
118.1973 |
| InChI |
InChI=1/C5H10OS/c1-3-4-7-5(2)6/h3-4H2,1-2H3 |
| CAS Registry Number |
2307-10-0 |
| EINECS |
218-984-7 |
| Estrutura Molecular |
|
| Densidade |
0.967g/cm3 |
| Ponto de ebuli??o |
141.4°C at 760 mmHg |
| índice de refra??o |
1.456 |
| O ponto de inflama??o |
36°C |
| Press?o de vapor |
5.87mmHg at 25°C |
| Códigos de risco |
R10:Flammable.;
|
| Descri??o da Seguran?a |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|