191-48-0 decacyclene
| Nome do produto |
decacyclene |
| Nome em inglês |
decacyclene; benzo(a,a,a)triacenaphthylene; diacenaphtho[1,2-j:1',2'-l]fluoranthene |
| Fórmula molecular |
C36H18 |
| Peso Molecular |
450.5281 |
| InChI |
InChI=1/C36H18/c1-7-19-8-2-14-23-28(19)22(13-1)31-32(23)34-26-17-5-11-21-12-6-18-27(30(21)26)36(34)35-25-16-4-10-20-9-3-15-24(29(20)25)33(31)35/h1-18H |
| CAS Registry Number |
191-48-0 |
| EINECS |
205-889-0 |
| Estrutura Molecular |
|
| Densidade |
1.467g/cm3 |
| Ponto de fus?o |
300℃ |
| índice de refra??o |
2.116 |
| Descri??o da Seguran?a |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|