14073-97-3 l-Menthone
| Nome do produto |
l-Menthone |
| Nome em inglês |
l-Menthone; (-)-5-Methyl-2-(1-methylethyl)cyclohexanone; Menthone Laevo Natural; (-)-menthan-3-one; (2S,5R)-5-methyl-2-(propan-2-yl)cyclohexanone |
| Fórmula molecular |
C10H18O |
| Peso Molecular |
154.2493 |
| InChI |
InChI=1/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-9H,4-6H2,1-3H3/t8-,9+/m1/s1 |
| CAS Registry Number |
14073-97-3 |
| EINECS |
237-926-1 |
| Estrutura Molecular |
|
| Densidade |
0.881g/cm3 |
| Ponto de ebuli??o |
205°C at 760 mmHg |
| índice de refra??o |
1.442 |
| O ponto de inflama??o |
72.8°C |
| Press?o de vapor |
0.256mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|