13265-84-4 D-glucal
| Nome do produto |
D-glucal |
| Nome em inglês |
D-glucal; 1,5-Anhydro-2-deoxy-D-arabino-hex-1-enitol; D-arabino-Hex-1-enitol, 1,5-anhydro-2-deoxy-; (4xi)-1,5-anhydro-2-deoxy-D-threo-hex-1-enitol |
| Fórmula molecular |
C6H10O4 |
| Peso Molecular |
146.1412 |
| InChI |
InChI=1/C6H10O4/c7-3-5-6(9)4(8)1-2-10-5/h1-2,4-9H,3H2/t4-,5-,6+/m1/s1 |
| CAS Registry Number |
13265-84-4 |
| EINECS |
236-259-3 |
| Estrutura Molecular |
|
| Densidade |
1.414g/cm3 |
| Ponto de fus?o |
58-60℃ |
| Ponto de ebuli??o |
325.5°C at 760 mmHg |
| índice de refra??o |
1.565 |
| O ponto de inflama??o |
150.7°C |
| Press?o de vapor |
1.77E-05mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|