105-61-3 N-Carbamoylmaleamic acid
| Nome do produto |
N-Carbamoylmaleamic acid |
| Nome em inglês |
N-Carbamoylmaleamic acid; Maleuric acid; Maleic acid monoureide~Maleuric acid; (2Z)-4-(carbamoylamino)-4-oxobut-2-enoic acid; (2E)-4-(carbamoylamino)-4-oxobut-2-enoic acid; 4-(carbamoylamino)-4-oxobut-2-enoate |
| Fórmula molecular |
C5H5N2O4 |
| Peso Molecular |
157.1047 |
| InChI |
InChI=1/C5H6N2O4/c6-5(11)7-3(8)1-2-4(9)10/h1-2H,(H,9,10)(H3,6,7,8,11)/p-1 |
| CAS Registry Number |
105-61-3 |
| EINECS |
203-314-8 |
| Estrutura Molecular |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|