9003-01-4;9007-20-9;54182-57-9 Acrylic acid Polymers
| Nazwa produktu: |
Acrylic acid Polymers |
| Angielska nazwa |
Acrylic acid Polymers; poly(1-carboxyethylene); Poly(acrylic acid); Acrylic Acid glacial; Fluorosulfuric acid; 2-Propenoic acid, homopolymer; Acrylic polymer resins; Polyacrylic Acid; Propenoic acid, homopolymer; Propenoic acid polymer; Propenoic acid, polymers, homopolymer; Carbopol; Carboxypoly-methylene; PAA; Carbomer 910; acrylicacid,poly; Carbomer |
| MF |
(C3H4O2)n |
| Masie cz?steczkowej |
72.06 |
| InChI |
InChI=1/C3H4O2/c1-2-3(4)5/h2H,1H2,(H,4,5) |
| Nr CAS |
9003-01-4;9007-20-9;54182-57-9 |
| EINECS |
202-415-4 |
| Struktury molekularnej |
|
| G?sto?? |
1.09 (30% aq.) |
| Temperatura wrzenia |
116 °C |
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|