593-96-4 1-Bromo-1-chloroethane
| Nazwa produktu: |
1-Bromo-1-chloroethane |
| Angielska nazwa |
1-Bromo-1-chloroethane;Ethane, 1-bromo-1-chloro- |
| MF |
C2H4BrCl |
| Masie cz?steczkowej |
143.4102 |
| InChI |
InChI=1/C2H4BrCl/c1-2(3)4/h2H,1H3 |
| Nr CAS |
593-96-4 |
| EINECS |
209-820-5 |
| Struktury molekularnej |
|
| G?sto?? |
1.658g/cm3 |
| Temperatura wrzenia |
79.5°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.463 |
| Ci?nienie pary |
98.1mmHg at 25°C |
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|