583-03-9 Fenipentol
| Nazwa produktu: |
Fenipentol |
| Angielska nazwa |
Fenipentol; .alpha.-Butylbenzenemethanol; .alpha.-Butylbenzyl alcohol; 1-Phenylpentan-1-ol; 583-03-9; a-Butylbenzyl Alcohol; Benzenemethanol, .alpha.-butyl-; benzenemethanol, alpha-butyl-; Benzyl alcohol, .alpha.-butyl-; Butyl hydroxy toluene |
| MF |
C11H16O |
| Masie cz?steczkowej |
164.2441 |
| InChI |
InChI=1/C11H16O/c1-2-3-9-11(12)10-7-5-4-6-8-10/h4-8,11-12H,2-3,9H2,1H3 |
| Nr CAS |
583-03-9 |
| EINECS |
209-493-9 |
| Struktury molekularnej |
|
| G?sto?? |
0.965g/cm3 |
| Temperatura wrzenia |
245.2°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.514 |
| Temperatura zap?onu |
110.7°C |
| Ci?nienie pary |
0.0156mmHg at 25°C |
| Bezpieczeństwo opis |
S24/25:Avoid contact with skin and eyes.;
|
|