480-16-0 Morin
| Nazwa produktu: |
Morin |
| Angielska nazwa |
Morin; C.I. 75660; C.I. Natural Yellow 8; 2,3,4,5,7-Pentahydroxyflavone; Fustic; Morin dihydrate; 2-(3,5-dihydroxyphenyl)-3,6,8-trihydroxy-4H-chromen-4-one; 2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one |
| MF |
C15H10O7 |
| Masie cz?steczkowej |
302.2357 |
| InChI |
InChI=1/C15H10O7/c16-6-1-2-8(9(18)3-6)15-14(21)13(20)12-10(19)4-7(17)5-11(12)22-15/h1-5,16-19,21H |
| Nr CAS |
480-16-0 |
| EINECS |
207-542-9 |
| Struktury molekularnej |
|
| G?sto?? |
1.799g/cm3 |
| Temperatura topnienia |
300℃ |
| Temperatura wrzenia |
645.5°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.823 |
| Temperatura zap?onu |
249.3°C |
| Ci?nienie pary |
2.94E-17mmHg at 25°C |
| Symbole zagro?enia |
Xi:Irritant;
|
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|