ChemNet > CAS > 35541-81-2 1,4-cyclohexanedimethanol dibenzoate
35541-81-2 1,4-cyclohexanedimethanol dibenzoate
| Nazwa produktu: |
1,4-cyclohexanedimethanol dibenzoate |
| Angielska nazwa |
1,4-cyclohexanedimethanol dibenzoate; 1,4-Cyclohexanedimethanol dibenzoate,mixture of cis and trans; cyclohexane-1,4-diyldimethanediyl dibenzoate; cyclohexane-1,4-diylbis(methylene) dibenzoate |
| MF |
C22H24O4 |
| Masie cz?steczkowej |
352.4236 |
| InChI |
InChI=1/C22H24O4/c23-21(19-7-3-1-4-8-19)25-15-17-11-13-18(14-12-17)16-26-22(24)20-9-5-2-6-10-20/h1-10,17-18H,11-16H2 |
| Nr CAS |
35541-81-2 |
| Struktury molekularnej |
|
| G?sto?? |
1.125g/cm3 |
| Temperatura wrzenia |
472.9°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.549 |
| Temperatura zap?onu |
233.7°C |
| Ci?nienie pary |
4.13E-09mmHg at 25°C |
|