| produktnavn |
Agarose |
| Engelsk navn |
Agarose; Agarose, medium EEO, Molecular Biology Grade; agarose, mixture; Agaroseforelectrophoresisofmacromolecules; agarose for molecular biology; agarose 6 B for chromatography; Agarose LE; sepharose(R) 4B for chromatography; sepharose(R) 6B for chromatography; Agarose ME; Agarose, Molecular Biology Grade; Agarose, ultra; Agaroseplasmaelectrophoresisgrade; Sepharose?6B; 5-Chloro-1,3-dimethyladamantane; sepharose(R) cl-6B for chromatography; Sepharose CL-6B; high resolution agarose; N,N'-methanediylbisprop-2-enamide - prop-2-enamide (1:1); beta-D-galactopyranosyl-(1->4)-3,6-anhydro-alpha-L-galactopyranosyl-(1->3)-beta-D-galactopyranosyl-(1->4)-3,6-anhydro-alpha-L-galactopyranose |
| Molekyl?r Formel |
C24H38O19 |
| Molekylvekt |
630.5471 |
| InChI |
InChI=1/C24H38O19/c25-1-5-9(27)11(29)12(30)22(38-5)41-17-8-4-36-20(17)15(33)24(40-8)43-18-10(28)6(2-26)39-23(14(18)32)42-16-7-3-35-19(16)13(31)21(34)37-7/h5-34H,1-4H2/t5-,6-,7+,8+,9+,10+,11+,12-,13+,14-,15+,16-,17-,18+,19+,20+,21-,22+,23+,24+/m1/s1 |
| CAS-nummer |
9012-36-6;39346-81-1;62610-50-8 |
| EINECS |
232-731-8 |
| Molecular Structure |
|
| Tetthet |
1.81g/cm3 |
| Smeltepunkt |
260-481.5℃ |
| Kokepunkt |
993.945°C at 760 mmHg |
| Brytningsindeks |
1.679 |
| Flammepunktet |
554.918°C |
| Damptrykk |
0mmHg at 25°C |
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|