ChemNet > CAS > 341-69-5 Orphenadrine hydrochloride
341-69-5 Orphenadrine hydrochloride
| produktnavn |
Orphenadrine hydrochloride |
| Engelsk navn |
Orphenadrine hydrochloride; N,N-Dimethyl-2-(o-methyl-alpha-phenylbenzyloxy)-ethylamine hydrochloride; N,N-dimethyl-2-[(2-methylphenyl)(phenyl)methoxy]ethanamine hydrochloride (1:1); N,N-dimethyl-2-[(R)-(2-methylphenyl)(phenyl)methoxy]ethanaminium; N,N-dimethyl-2-[(S)-(2-methylphenyl)(phenyl)methoxy]ethanaminium |
| Molekyl?r Formel |
C18H24NO |
| Molekylvekt |
270.3887 |
| InChI |
InChI=1/C18H23NO/c1-15-9-7-8-12-17(15)18(20-14-13-19(2)3)16-10-5-4-6-11-16/h4-12,18H,13-14H2,1-3H3/p+1/t18-/m0/s1 |
| CAS-nummer |
341-69-5 |
| EINECS |
206-435-4 |
| Molecular Structure |
|
| Smeltepunkt |
159-162℃ |
| Kokepunkt |
363°C at 760 mmHg |
| Flammepunktet |
107.1°C |
| Damptrykk |
1.86E-05mmHg at 25°C |
| Hazard symboler |
Xn:Harmful;
|
| Risiko Koder |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|