86-79-3 2-Hydroxycarbazole
| Naam product |
2-Hydroxycarbazole |
| Engelse naam |
2-Hydroxycarbazole; carbazol-2-ol; 9H-carbazol-2-ol; 2-Hydroxy-9H-carbazole |
| MF |
C12H9NO |
| Molecuulgewicht |
183.206 |
| InChI |
InChI=1/C12H9NO/c14-8-5-6-10-9-3-1-2-4-11(9)13-12(10)7-8/h1-7,13-14H |
| CAS-nummer |
86-79-3 |
| EINECS |
201-699-7 |
| Moleculaire Structuur |
|
| Dichtheid |
1.362g/cm3 |
| Smeltpunt |
273-275℃ |
| Kookpunt |
431.4°C at 760 mmHg |
| Brekingsindex |
1.815 |
| Vlampunt |
214.7°C |
| Dampdruk |
4.78E-08mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|