80384-27-6 Z-D-threonine
| Naam product |
Z-D-threonine |
| Engelse naam |
Z-D-threonine; Z-D-Thr-OH; N-Cbz-D-threonine; N-Benzyloxycarbonyl-D-threonine~Z-D-Thr-OH; (2R)-2-benzyloxycarbonylamino-3-hydroxy-butanoic acid; Cbz-D-threonine |
| MF |
C12H15NO5 |
| Molecuulgewicht |
253.2512 |
| InChI |
InChI=1/C12H15NO5/c1-8(14)10(11(15)16)13-12(17)18-7-9-5-3-2-4-6-9/h2-6,8,10,14H,7H2,1H3,(H,13,17)(H,15,16)/t8?,10-/m1/s1 |
| CAS-nummer |
80384-27-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.309g/cm3 |
| Kookpunt |
483.7°C at 760 mmHg |
| Brekingsindex |
1.561 |
| Vlampunt |
246.3°C |
| Dampdruk |
3.62E-10mmHg at 25°C |
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|