77-79-2 Butadiene sulfone
| Naam product |
Butadiene sulfone |
| Engelse naam |
Butadiene sulfone; 2,5-Dihydrothiophene-1,1-dioxide; 3-Sulfolene; Dihydrothiophene-1,1-dioxide; Butadiene sulphone; Cyclobutenesulfone |
| MF |
C4H6O2S |
| Molecuulgewicht |
118.15 |
| InChI |
InChI=1/C4H6O2S/c5-7(6)3-1-2-4-7/h1-2H,3-4H2 |
| CAS-nummer |
77-79-2 |
| EINECS |
201-059-7 |
| Moleculaire Structuur |
|
| Dichtheid |
1.314 |
| Smeltpunt |
63-66℃ |
| Vlampunt |
112℃ |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|