698-67-9 4-Bromobenzamide
| Naam product |
4-Bromobenzamide |
| Engelse naam |
4-Bromobenzamide; 4-Bromobenzamide,97%; p-bromo-benzamid; p-bromobenzoicacidamide; P-BROMOBENZAMIDE |
| MF |
C7H6BrNO |
| Molecuulgewicht |
200.0326 |
| InChI |
InChI=1/C7H6BrNO/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H2,9,10) |
| CAS-nummer |
698-67-9 |
| EINECS |
211-817-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.609g/cm3 |
| Smeltpunt |
189-194℃ |
| Kookpunt |
309.9°C at 760 mmHg |
| Brekingsindex |
1.605 |
| Vlampunt |
141.2°C |
| Dampdruk |
0.000621mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|