ChemNet > CAS > 618-31-5 Alpha,Alpha-Dibromotoluene
618-31-5 Alpha,Alpha-Dibromotoluene
| Naam product |
Alpha,Alpha-Dibromotoluene |
| Engelse naam |
Alpha,Alpha-Dibromotoluene; Benzal bromide; (dibromomethyl)benzene |
| MF |
C7H6Br2 |
| Molecuulgewicht |
249.9305 |
| InChI |
InChI=1/C7H6Br2/c8-7(9)6-4-2-1-3-5-6/h1-5,7H |
| CAS-nummer |
618-31-5 |
| EINECS |
210-543-7 |
| Moleculaire Structuur |
|
| Dichtheid |
1.881g/cm3 |
| Kookpunt |
276.6°C at 760 mmHg |
| Brekingsindex |
1.619 |
| Vlampunt |
100.2°C |
| Dampdruk |
0.00802mmHg at 25°C |
| Gevaarsymbolen |
T:Toxic;
|
| Risico-codes |
R23/24:Toxic by inhalation and in contact with skin.;
R33:Danger of cummulative effects.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|