589-98-0;20296-29-1 3-Octanol
| Naam product |
3-Octanol |
| Engelse naam |
3-Octanol; DL-3-Octanol; ethylpentylcarbinol; n-Amyl ethyl carbinol; Ethyl n-pentyl carbinol; (3S)-octan-3-ol; (±)-octan-3-ol; (3R)-octan-3-ol |
| MF |
C8H18O |
| Molecuulgewicht |
130.2279 |
| InChI |
InChI=1/C8H18O/c1-3-5-6-7-8(9)4-2/h8-9H,3-7H2,1-2H3/t8-/m0/s1 |
| CAS-nummer |
589-98-0;20296-29-1 |
| EINECS |
209-667-4 |
| Moleculaire Structuur |
|
| Dichtheid |
0.821g/cm3 |
| Smeltpunt |
-45℃ |
| Kookpunt |
169°C at 760 mmHg |
| Brekingsindex |
1.426 |
| Vlampunt |
65.6°C |
| Dampdruk |
0.512mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|