565-60-6 3-Methyl-2-pentanol
| Naam product |
3-Methyl-2-pentanol |
| Engelse naam |
3-Methyl-2-pentanol; 2-pentanol, 3-methyl-; 3-Methylpentan-2-ol; Threo-3-methylpentan-2-ol; (2R,3R)-3-methylpentan-2-ol; (2R,3S)-3-methylpentan-2-ol; (2S,3R)-3-methylpentan-2-ol; (2S,3S)-3-methylpentan-2-ol |
| MF |
C6H14O |
| Molecuulgewicht |
102.1748 |
| InChI |
InChI=1/C6H14O/c1-4-5(2)6(3)7/h5-7H,4H2,1-3H3/t5-,6-/m0/s1 |
| CAS-nummer |
565-60-6 |
| EINECS |
209-281-6 |
| Moleculaire Structuur |
|
| Dichtheid |
0.811g/cm3 |
| Kookpunt |
133.5°C at 760 mmHg |
| Brekingsindex |
1.411 |
| Vlampunt |
40.6°C |
| Dampdruk |
3.68mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R10:Flammable.;
R37:Irritating to respiratory system.;
|
| Veiligheid Omschrijving |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
|
|