543-20-4 Succinyl chloride
| Naam product |
Succinyl chloride |
| Engelse naam |
Succinyl chloride; Succinic acid dichloride; Succinyl dichloride; Succinoyl dichloride; Butanedioyl dichloride |
| MF |
C4H4Cl2O2 |
| Molecuulgewicht |
154.9794 |
| InChI |
InChI=1/C4H4Cl2O2/c5-3(7)1-2-4(6)8/h1-2H2 |
| CAS-nummer |
543-20-4 |
| EINECS |
208-838-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.389g/cm3 |
| Smeltpunt |
16-17℃ |
| Kookpunt |
193.4°C at 760 mmHg |
| Brekingsindex |
1.456 |
| Vlampunt |
76.7°C |
| Dampdruk |
0.466mmHg at 25°C |
| Gevaarsymbolen |
C:Corrosive;
|
| Risico-codes |
R34:Causes burns.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|