528-48-3 Fisetin
| Naam product |
Fisetin |
| Engelse naam |
Fisetin; C.I. 75620; C.I. Natural Brown 1; 3,3,4,7-Tetrahydroxyflavone; 2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-4H-chromen-4-one |
| MF |
C15H10O6 |
| Molecuulgewicht |
286.2363 |
| InChI |
InChI=1/C15H10O6/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7/h1-6,16-18,20H |
| CAS-nummer |
528-48-3 |
| EINECS |
208-434-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.688g/cm3 |
| Smeltpunt |
330℃ |
| Kookpunt |
599.4°C at 760 mmHg |
| Brekingsindex |
1.784 |
| Vlampunt |
233°C |
| Dampdruk |
3.23E-15mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|