486-84-0 Harmane
| Naam product |
Harmane |
| Engelse naam |
Harmane; 1-Methyl-9H-pyrido[3,4-b]indole; Aribine~1-Methyl-9H-pyrido[3,4-b]indole; harman; 1-methyl-9H-beta-carboline; 2-Methyl-?carboline; Aribine; 1-methyl-9H-beta-carboline |
| MF |
C12H10N2 |
| Molecuulgewicht |
182.2212 |
| InChI |
InChI=1/C12H10N2/c1-8-12-10(6-7-13-8)9-4-2-3-5-11(9)14-12/h2-7,14H,1H3 |
| CAS-nummer |
486-84-0 |
| EINECS |
207-642-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.252g/cm3 |
| Smeltpunt |
235-239℃ |
| Kookpunt |
386.9°C at 760 mmHg |
| Brekingsindex |
1.75 |
| Vlampunt |
176.2°C |
| Dampdruk |
7.61E-06mmHg at 25°C |
| Gevaarsymbolen |
Xn:Harmful;
|
| Risico-codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
|
|