ChemNet > CAS > 4495-66-3 4'-Benzyloxypropiophenone
4495-66-3 4'-Benzyloxypropiophenone
| Naam product |
4'-Benzyloxypropiophenone |
| Engelse naam |
4'-Benzyloxypropiophenone; 4-Benzyloxypropiophenone; 1-[4-(benzyloxy)phenyl]propan-1-one; 1-(4-(benzyloxy)phenyl)propan-1-one |
| MF |
C16H16O2 |
| Molecuulgewicht |
240.297 |
| InChI |
InChI=1/C16H16O2/c1-2-16(17)14-8-10-15(11-9-14)18-12-13-6-4-3-5-7-13/h3-11H,2,12H2,1H3 |
| CAS-nummer |
4495-66-3 |
| EINECS |
224-788-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.081g/cm3 |
| Smeltpunt |
99-102℃ |
| Kookpunt |
391°C at 760 mmHg |
| Brekingsindex |
1.562 |
| Vlampunt |
174.4°C |
| Dampdruk |
2.54E-06mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|