3878-55-5 mono-Methyl succinate
| Naam product |
mono-Methyl succinate |
| Engelse naam |
mono-Methyl succinate; Succinic acid monomethyl ester; methyl hydrogen succinate; mono-Methyl hydrogen succinate; 4-Methoxy-4-oxobutanoic acid; 4-methoxy-4-oxobutanoate |
| MF |
C5H7O4 |
| Molecuulgewicht |
131.1072 |
| InChI |
InChI=1/C5H8O4/c1-9-5(8)3-2-4(6)7/h2-3H2,1H3,(H,6,7)/p-1 |
| CAS-nummer |
3878-55-5 |
| EINECS |
223-408-2 |
| Moleculaire Structuur |
|
| Smeltpunt |
55-59℃ |
| Kookpunt |
259.2°C at 760 mmHg |
| Vlampunt |
104.5°C |
| Dampdruk |
0.00394mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|