3121-71-9 1-Naphthyl propionate
| Naam product |
1-Naphthyl propionate |
| Engelse naam |
1-Naphthyl propionate;1-Naphthalenol, propanoate; AI3-18247; NSC 408079; naphthalen-1-yl propanoate |
| MF |
C13H12O2 |
| Molecuulgewicht |
200.2332 |
| InChI |
InChI=1/C13H12O2/c1-2-13(14)15-12-9-5-7-10-6-3-4-8-11(10)12/h3-9H,2H2,1H3 |
| CAS-nummer |
3121-71-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.126g/cm3 |
| Smeltpunt |
34℃ |
| Kookpunt |
312.4°C at 760 mmHg |
| Brekingsindex |
1.591 |
| Vlampunt |
113.8°C |
| Dampdruk |
0.000532mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|