2089-36-3 Piperonaldoxime
| Naam product |
Piperonaldoxime |
| Engelse naam |
Piperonaldoxime; Piperonaldoxime, (3,4-Methylenedioxybenzaldoxime); 1,3-Benzodioxole-5-carboxaldoxime~3,4-(Methylenedioxy)benzaldoxime; 1-(1,3-benzodioxol-5-yl)-N-hydroxymethanimine; 1,3-benzodioxole-5-carbaldehyde oxime |
| MF |
C8H7NO3 |
| Molecuulgewicht |
165.1461 |
| InChI |
InChI=1/C8H7NO3/c10-9-4-6-1-2-7-8(3-6)12-5-11-7/h1-4,10H,5H2/b9-4+ |
| CAS-nummer |
2089-36-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.38g/cm3 |
| Kookpunt |
279.8°C at 760 mmHg |
| Brekingsindex |
1.603 |
| Vlampunt |
123°C |
| Dampdruk |
0.00187mmHg at 25°C |
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|