2039-76-1 3-acetylphenanthrene
| Naam product |
3-acetylphenanthrene |
| Engelse naam |
3-acetylphenanthrene; methyl 3-phenanthryl ketone; 1-(phenanthren-3-yl)ethanone |
| MF |
C16H12O |
| Molecuulgewicht |
220.2659 |
| InChI |
InChI=1/C16H12O/c1-11(17)14-9-8-13-7-6-12-4-2-3-5-15(12)16(13)10-14/h2-10H,1H3 |
| CAS-nummer |
2039-76-1 |
| EINECS |
218-020-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.164g/cm3 |
| Smeltpunt |
67-71℃ |
| Kookpunt |
405.9°C at 760 mmHg |
| Brekingsindex |
1.685 |
| Vlampunt |
180.7°C |
| Dampdruk |
8.47E-07mmHg at 25°C |
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|