ChemNet > CAS > 17159-80-7 ethyl 4-hydroxycyclohexanecarboxylate
17159-80-7 ethyl 4-hydroxycyclohexanecarboxylate
| Naam product |
ethyl 4-hydroxycyclohexanecarboxylate |
| Engelse naam |
ethyl 4-hydroxycyclohexanecarboxylate; Ethyl 4-hydroxycyclohexanecarboxylate,mixture of cis and trans; Ethyl 4-hydroxycyclohexane carboxylate |
| MF |
C9H16O3 |
| Molecuulgewicht |
172.2215 |
| InChI |
InChI=1/C9H16O3/c1-2-12-9(11)7-3-5-8(10)6-4-7/h7-8,10H,2-6H2,1H3 |
| CAS-nummer |
17159-80-7 |
| EINECS |
241-215-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.093g/cm3 |
| Kookpunt |
251.4°C at 760 mmHg |
| Brekingsindex |
1.481 |
| Vlampunt |
100.2°C |
| Dampdruk |
0.00322mmHg at 25°C |
|