114-33-0 N-Methylnicotinamide
| Naam product |
N-Methylnicotinamide |
| Engelse naam |
N-Methylnicotinamide; Methylnicotinamide; N-methylpyridine-3-carboxamide |
| MF |
C7H8N2O |
| Molecuulgewicht |
136.1512 |
| InChI |
InChI=1/C7H8N2O/c1-8-7(10)6-3-2-4-9-5-6/h2-5H,1H3,(H,8,10) |
| CAS-nummer |
114-33-0 |
| EINECS |
204-046-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.106g/cm3 |
| Smeltpunt |
100-105℃ |
| Kookpunt |
347.7°C at 760 mmHg |
| Brekingsindex |
1.529 |
| Vlampunt |
164.1°C |
| Dampdruk |
5.3E-05mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|