110-14-5 Succinamide
| Naam product |
Succinamide |
| Engelse naam |
Succinamide; Butanediamide; Succinic diamide; Butanedioic acid diamide |
| MF |
C4H8N2O2 |
| Molecuulgewicht |
116.1185 |
| InChI |
InChI=1/C4H8N2O2/c5-3(7)1-2-4(6)8/h1-2H2,(H2,5,7)(H2,6,8) |
| CAS-nummer |
110-14-5 |
| EINECS |
203-739-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.207g/cm3 |
| Smeltpunt |
260-265℃ |
| Kookpunt |
494°C at 760 mmHg |
| Brekingsindex |
1.488 |
| Vlampunt |
252.6°C |
| Dampdruk |
6.7E-10mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|