1036-72-2 5,7-dimethoxyflavanon
| Naam product |
5,7-dimethoxyflavanon |
| Synoniemen |
;P inocembrinedimethylether; 5,7-dimethoxy-2-fenyl-2,3-dihydro-4H-chromen-4-on |
| Engelse naam |
5,7-Dimethoxyflavanone; Pinocembrin dimethyl ether; 5,7-dimethoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |
| MF |
C17H16O4 |
| Molecuulgewicht |
284.3065 |
| InChI |
InChI=1/C17H16O4/c1-19-12-8-15(20-2)17-13(18)10-14(21-16(17)9-12)11-6-4-3-5-7-11/h3-9,14H,10H2,1-2H3 |
| CAS-nummer |
1036-72-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.204g/cm3 |
| Kookpunt |
468.8°C at 760 mmHg |
| Brekingsindex |
1.574 |
| Vlampunt |
209.4°C |
| Dampdruk |
5.79E-09mmHg at 25°C |
| Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|