1036-72-2 5,7-Dimetoxiflavanona
| Nome do produto |
5,7-Dimetoxiflavanona |
| Sin?nimos |
;P éter dimetílico inocembrina; 5,7-dimetoxi-2-fenil-2,3-diidro-4H-cromeno-4-ona |
| Nome em inglês |
5,7-Dimethoxyflavanone; Pinocembrin dimethyl ether; 5,7-dimethoxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |
| Fórmula molecular |
C17H16O4 |
| Peso Molecular |
284.3065 |
| InChI |
InChI=1/C17H16O4/c1-19-12-8-15(20-2)17-13(18)10-14(21-16(17)9-12)11-6-4-3-5-7-11/h3-9,14H,10H2,1-2H3 |
| CAS Registry Number |
1036-72-2 |
| Estrutura Molecular |
|
| Densidade |
1.204g/cm3 |
| Ponto de ebuli??o |
468.8°C at 760 mmHg |
| índice de refra??o |
1.574 |
| O ponto de inflama??o |
209.4°C |
| Press?o de vapor |
5.79E-09mmHg at 25°C |
| Descri??o da Seguran?a |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|