64-65-3 Bemegride
| Nama produk |
Bemegride |
| Nama Inggeris |
Bemegride; 3-Ethyl-3-methylglutarimide; 4-Ethyl-4-methyl-2,6-piperidinedione; 3-Methyl-3-ethylglutarimide; 4-ethyl-4-methylpiperidine-2,6-dione |
| MF |
C8H13NO2 |
| Berat Molekul |
155.1943 |
| InChI |
InChI=1/C8H13NO2/c1-3-8(2)4-6(10)9-7(11)5-8/h3-5H2,1-2H3,(H,9,10,11) |
| CAS NO |
64-65-3 |
| EINECS |
200-588-0 |
| Struktur Molekul |
|
| Kepadatan |
1.024g/cm3 |
| Titik lebur |
126-129℃ |
| Titik didih |
282°C at 760 mmHg |
| Indeks bias |
1.448 |
| Titik nyala |
125.8°C |
| Tekanan wap |
0.00344mmHg at 25°C |
| Cinta bahaya |
T:Toxic;
|
| Kod Risiko |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|