4567-98-0 dimethyl undecanedioate
| Nama produk |
dimethyl undecanedioate |
| Sinonim |
; 224-943-4; asid undecanedioic, dimethyl ester |
| Nama Inggeris |
dimethyl undecanedioate; 224-943-4; undecanedioic acid, dimethyl ester |
| MF |
C13H24O4 |
| Berat Molekul |
244.3273 |
| InChI |
InChI=1/C13H24O4/c1-16-12(14)10-8-6-4-3-5-7-9-11-13(15)17-2/h3-11H2,1-2H3 |
| CAS NO |
4567-98-0 |
| EINECS |
224-943-4 |
| Struktur Molekul |
|
| Kepadatan |
0.976g/cm3 |
| Titik lebur |
17-19℃ |
| Titik didih |
287.7°C at 760 mmHg |
| Indeks bias |
1.439 |
| Titik nyala |
129.2°C |
| Tekanan wap |
0.00244mmHg at 25°C |
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|