4567-98-0 dimethylundecaandioaat
| Naam product |
dimethylundecaandioaat |
| Synoniemen |
224-943-4; undecaandizuur, dimethylester |
| Engelse naam |
dimethyl undecanedioate; 224-943-4; undecanedioic acid, dimethyl ester |
| MF |
C13H24O4 |
| Molecuulgewicht |
244.3273 |
| InChI |
InChI=1/C13H24O4/c1-16-12(14)10-8-6-4-3-5-7-9-11-13(15)17-2/h3-11H2,1-2H3 |
| CAS-nummer |
4567-98-0 |
| EINECS |
224-943-4 |
| Moleculaire Structuur |
|
| Dichtheid |
0.976g/cm3 |
| Smeltpunt |
17-19℃ |
| Kookpunt |
287.7°C at 760 mmHg |
| Brekingsindex |
1.439 |
| Vlampunt |
129.2°C |
| Dampdruk |
0.00244mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|