ChemNet > CAS > 350-90-3 Alpha-Fluorocinnamic acid
350-90-3 Alpha-Fluorocinnamic acid
| Nama produk |
Alpha-Fluorocinnamic acid |
| Nama Inggeris |
Alpha-Fluorocinnamic acid;Cinnamic acid, alpha-fluoro-; 1-09-00-00237 (Beilstein Handbook Reference); 2-Fluoro-3-phenyl-2-propenoic acid; BRN 2501318; NSC 102780; alpha-Fluorocinnamic acid; 2-Propenoic acid, 2-fluoro-3-phenyl- (9CI); 2-fluoro-3-phenylprop-2-enoic acid; (2Z)-2-fluoro-3-phenylprop-2-enoate; (2Z)-2-fluoro-3-phenylprop-2-enoic acid |
| MF |
C9H7FO2 |
| Berat Molekul |
166.1491 |
| InChI |
InChI=1/C9H7FO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-6H,(H,11,12)/b8-6- |
| CAS NO |
350-90-3 |
| EINECS |
206-508-0 |
| Struktur Molekul |
|
| Kepadatan |
1.275g/cm3 |
| Titik lebur |
156-160℃ |
| Titik didih |
289.3°C at 760 mmHg |
| Indeks bias |
1.585 |
| Titik nyala |
128.7°C |
| Tekanan wap |
0.00103mmHg at 25°C |
| Cinta bahaya |
Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|