ChemNet > CAS > 332-48-9 4-Fluorophenoxy-ethylbromide
332-48-9 4-Fluorophenoxy-ethylbromide
| Nama produk |
4-Fluorophenoxy-ethylbromide |
| Nama Inggeris |
4-Fluorophenoxy-ethylbromide; 1-(2-Bromoethoxy)-4-fluorobenzene; 1-(1-bromoethoxy)-4-fluorobenzene |
| MF |
C8H8BrFO |
| Berat Molekul |
219.0509 |
| InChI |
InChI=1/C8H8BrFO/c1-6(9)11-8-4-2-7(10)3-5-8/h2-6H,1H3 |
| CAS NO |
332-48-9 |
| Struktur Molekul |
|
| Kepadatan |
1.483g/cm3 |
| Titik didih |
242.309°C at 760 mmHg |
| Indeks bias |
1.525 |
| Titik nyala |
119.849°C |
| Tekanan wap |
0.053mmHg at 25°C |
| Cinta bahaya |
Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|