| Nama produk |
Tacrine |
| Nama Inggeris |
Tacrine; THA; 1,2,3,4-Tetrahydro-9-acridinamine; 9-Amino-1,2,3,4-tetrahydroacridine; Cognex; 9-Acridinamine, 1,2,3,4-tetrahydro-; 1,2,3,4-Tetrahydro-acridin-9-ylamine |
| MF |
C13H14N2.HCl.H2O |
| Berat Molekul |
252.74 |
| InChI |
InChI=1/C13H14N2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1,3,5,7H,2,4,6,8H2,(H2,14,15) |
| CAS NO |
321-64-2 |
| EINECS |
206-291-2 |
| Struktur Molekul |
|
| Titik lebur |
283-284℃ |
| Cinta bahaya |
T:Toxic;
|
| Kod Risiko |
R25:Toxic if swallowed.;
|
| Keselamatan Penerangan |
S28A:After contact with skin, wash immediately with plenty of water.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|