103-19-5 p-Tolyl disulfide
| Nama produk |
p-Tolyl disulfide |
| Nama Inggeris |
p-Tolyl disulfide; |
| MF |
C14H14S2 |
| Berat Molekul |
246.391 |
| InChI |
InChI=1/C14H14S2/c1-11-3-7-13(8-4-11)15-16-14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| CAS NO |
103-19-5 |
| EINECS |
203-087-5 |
| Struktur Molekul |
|
| Kepadatan |
1.17g/cm3 |
| Titik lebur |
43-46℃ |
| Titik didih |
349.5°C at 760 mmHg |
| Indeks bias |
1.649 |
| Titik nyala |
192.6°C |
| Tekanan wap |
9.46E-05mmHg at 25°C |
| Cinta bahaya |
Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|