| ???? |
Chloranilic acid |
| ?? ?? |
Chloranilic acid;2,5-Dichloro-3,6-Dihydroxy-P-Quinone; 2,5-Dichloro-3,6-Dihydroxyquinone; 2,5-Dichloro-3,6-Dihydroxy-P-Benzoquinone; Labotest-Bb Lt00159487; Timtec-Bb Sbb008913; 2,5-Cyclohexadiene-1,4-Dione, 2,5-Dichloro-3,6-Dihydroxy-; 2,5-Cyclohexadiene-1,4-Dione,2,5-Dichloro-3,6-Dihydroxy-; 2,5-Dichloro-3,6-Dihydroxybenzo-1,4-Quinone; 2,5-Dichloro-3,6-Dihydroxy-P-Benzoquinon; 2,5-Dichloro-3,6-Dihydroxy-P-Quinon; 2,5-Dihydroxy-3,6-Dichlorobenzoquinone; 4-Dione,2,5-Dichloro-3,6-Dihydroxy-5-Cyclohexadiene-1; 5-Cyclohexadiene-1,4-Dione,2,5-Dichloro-3,6-Dihydroxy-2; Chloranilic; P-Benzoquinone, 2,5-Dichloro-3,6-Dihydroxy-; P-Chloranilicacid; 2,5-Dichloro-3,6-Dihydroxybenzoquinone; Chloranilic Acid Crystalline; 2,5-Dyhydroxy-3,6-2-Benzoquinone; 2,5-Dochloro-3,6-Dyhydroxybenzoquinone; Chlorobenzene Acid; 2,5-Dochloro-3,6-Dohydroxy-P-Benzoquinone; 2,5-Dochloro-3,6-Dihydroxy Benzoquinone; Dichloro Hydroquinone; 2,5-Dichloro-3,6-Dihydroxy-1,4-Benzoquinone; Chloranilic Acid,(2,5-Dichloro-3,6-Dihydroxy-1,4; 2,5-dichloro-3,6-dihydroxycyclohexa-2,5-diene-1,4-dione |
| ??? |
C6H2Cl2O4 |
| ??? |
208.9837 |
| InChI |
InChI=1/C6H2Cl2O4/c7-1-3(9)5(11)2(8)6(12)4(1)10/h9,12H |
| cas?? |
87-88-7 |
| EC?? |
201-780-7 |
| ?? ?? |
|
| ?? |
1.93g/cm3 |
| ?? ? |
282-284℃ |
| ??? |
300.3°C at 760 mmHg |
| ?? ?? |
1.654 |
| ??? |
135.4°C |
| ??? |
0.000111mmHg at 25°C |
| ??? ?? |
Xi:Irritant;
|
| ??? ?? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ?? ?? |
S24/25:Avoid contact with skin and eyes.;
|
|