557-11-9 Allylurea
| ???? |
Allylurea |
| ?? ?? |
Allylurea;2-Propenylurea; 1-Allylurea; 4-04-00-01070 (Beilstein Handbook Reference); AI3-23204; Allyl urea; Allylcarbamide; BRN 1745068; CCRIS 5958; Monoallylurea; N-2-Propenylurea; N-Allylurea; NSC 7607; Urea, 2-propenyl-; Urea, N-2-propen-1-yl-; Urea, allyl-; 1-prop-2-en-1-ylurea |
| ??? |
C4H8N2O |
| ??? |
100.1191 |
| InChI |
InChI=1/C4H8N2O/c1-2-3-6-4(5)7/h2H,1,3H2,(H3,5,6,7) |
| cas?? |
557-11-9 |
| EC?? |
209-157-1 |
| ?? ?? |
|
| ?? |
1.008g/cm3 |
| ?? ? |
80-85℃ |
| ??? |
167.9°C at 760 mmHg |
| ?? ?? |
1.465 |
| ??? |
55.3°C |
| ??? |
1.66mmHg at 25°C |
| ??? ?? |
Xn:Harmful;
|
| ??? ?? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| ?? ?? |
S36/37:Wear suitable protective clothing and gloves.;
|
|