1534-08-3 S-Methyl thioacetate
| ???? |
S-Methyl thioacetate |
| ?? ?? |
S-Methyl thioacetate; Thioacetic acid S-methyl ester; S-methyl ethanethioate; methyl ethane(dithioate); (methylsulfanyl)acetate; Methyl thioacetate; Methanethiol acetate |
| ??? |
C3H7O2S |
| ??? |
107.152 |
| InChI |
InChI=1/C2H4O2.CH4S/c1-2(3)4;1-2/h1H3,(H,3,4);2H,1H3/p-1 |
| cas?? |
1534-08-3 |
| EC?? |
216-252-1 |
| ?? ?? |
|
| ??? ?? |
R11:Highly flammable.;
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| ?? ?? |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S29:Do not empty into drains.;
S36/37:Wear suitable protective clothing and gloves.;
|
|