1320-06-5 Oil Red O
| ???? |
Oil Red O |
| ?? ?? |
Oil Red O; C.I. Solvent Red 27; Oil red O; C.I. 26125; Solvent Red 27; oil red O electrophoresis; Transparent Red 5B; (1Z)-1-({4-[(E)-(2,5-dimethylphenyl)diazenyl]-2,5-dimethylphenyl}hydrazono)naphthalen-2(1H)-one; 1-({4-[(E)-(2,5-dimethylphenyl)diazenyl]-2,5-dimethylphenyl}hydrazono)naphthalen-2(1H)-one; 1-[(E)-{4-[(E)-(2,5-dimethylphenyl)diazenyl]-2,5-dimethylphenyl}diazenyl]naphthalen-2-ol; Oil red 3012 |
| ??? |
C26H24N4O |
| ??? |
408.495 |
| InChI |
InChI=1/C26H24N4O/c1-16-9-10-17(2)22(13-16)27-28-23-14-19(4)24(15-18(23)3)29-30-26-21-8-6-5-7-20(21)11-12-25(26)31/h5-15,31H,1-4H3/b28-27+,30-29+ |
| cas?? |
1320-06-5 |
| EC?? |
215-295-3 |
| ?? ?? |
|
| ?? |
1.16g/cm3 |
| ?? ? |
120℃ |
| ??? |
638.8°C at 760 mmHg |
| ?? ?? |
1.631 |
| ??? |
439.7°C |
| ??? |
6.46E-17mmHg at 25°C |
| ?? ?? |
S24/25:Avoid contact with skin and eyes.;
|
|