ChemNet > CAS > 93-65-2 2-(4-Chloro-2-methylphenoxy)propionic acid
93-65-2 2-(4-Chloro-2-methylphenoxy)propionic acid
| Nome del prodotto |
2-(4-Chloro-2-methylphenoxy)propionic acid |
| Nome inglese |
2-(4-Chloro-2-methylphenoxy)propionic acid; 2-(4-Chloro-o-tolyloxy)propionic acid; MCPP; Mecoprop; (-)-2-(4-chloro-o-tolyloxy)propionic acid; (2S)-2-(4-chloro-2-methylphenoxy)propanoic acid |
| Formula molecolare |
C10H11ClO3 |
| Peso Molecolare |
214.6455 |
| InChI |
InChI=1/C10H11ClO3/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13/h3-5,7H,1-2H3,(H,12,13)/t7-/m0/s1 |
| Numero CAS |
93-65-2 |
| EINECS |
202-264-4;230-386-8 [1] |
| Struttura molecolare |
|
| Densità |
1.265g/cm3 |
| Punto di ebollizione |
331.9°C at 760 mmHg |
| Indice di rifrazione |
1.542 |
| Punto d'infiammabilità |
154.5°C |
| Solubilità in acqua |
734 mg l-1 |
| Pressione di vapore |
6.04E-05mmHg at 25°C |
| Codici di Rischio |
R22:Harmful if swallowed.;
R38:Irritating to skin.;
R41:Risks of serious damage to eyes.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|