| Nome del prodotto |
dl-3-phenyllactic acid |
| Nome inglese |
dl-3-phenyllactic acid; DL-?-Phenyllactic acid ()-2-Hydroxy-3-phenylpropionic acid; (+/-)-3-Phenyllactic acid; (+/-)-2-Hydroxy-3-phenylpropionic acid; DL-3-Phenyllactic acid, (DL-2-Hydroxy-3-phenylpropionic acid); 3,3',3'',3'''-[3,8-bis(carboxymethyl)-13,17-dimethylporphyrin-2,7,12,18-tetrayl]tetrapropanoic acid; Dl-Beta-Phenyllactic Acid |
| Formula molecolare |
C38H38N4O12 |
| Peso Molecolare |
742.7279 |
| InChI |
InChI=1/C38H38N4O12/c1-17-19(3-7-33(43)44)27-14-29-21(5-9-35(47)48)24(12-38(53)54)32(41-29)16-30-22(6-10-36(49)50)23(11-37(51)52)31(42-30)15-28-20(4-8-34(45)46)18(2)26(40-28)13-25(17)39-27/h13-16,40-41H,3-12H2,1-2H3,(H,43,44)(H,45,46)(H,47,48)(H,49,50)(H,51,52)(H,53,54)/b25-13-,26-13-,27-14-,28-15-,29-14-,30-16-,31-15-,32-16- |
| Numero CAS |
828-01-3 |
| EINECS |
212-580-4 |
| Struttura molecolare |
|
| Densità |
1.478g/cm3 |
| Punto di fusione |
95-98℃ |
| Punto di ebollizione |
1399.4°C at 760 mmHg |
| Indice di rifrazione |
1.656 |
| Punto d'infiammabilità |
800.1°C |
| Pressione di vapore |
0mmHg at 25°C |
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|