823-22-3 delta-Hexanolactone
| Nome del prodotto |
delta-Hexanolactone |
| Nome inglese |
delta-Hexanolactone; delta-Hexalactone; 5-Hydroxyhexanoic acid lactone; 6-methyltetrahydro-2H-pyran-2-one; (6S)-6-methyltetrahydro-2H-pyran-2-one |
| Formula molecolare |
C6H10O2 |
| Peso Molecolare |
114.1424 |
| InChI |
InChI=1/C6H10O2/c1-5-3-2-4-6(7)8-5/h5H,2-4H2,1H3/t5-/m0/s1 |
| Numero CAS |
823-22-3 |
| EINECS |
212-511-8 |
| Struttura molecolare |
|
| Densità |
1.001g/cm3 |
| Punto di ebollizione |
215.7°C at 760 mmHg |
| Indice di rifrazione |
1.43 |
| Punto d'infiammabilità |
79.8°C |
| Pressione di vapore |
0.145mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|