816-40-0 1-bromo-2-butanone
| Nome del prodotto |
1-bromo-2-butanone |
| Nome inglese |
1-bromo-2-butanone; Bromomethyl ethyl ketone; 1-bromobutan-2-one |
| Formula molecolare |
C4H7BrO |
| Peso Molecolare |
151.0018 |
| InChI |
InChI=1/C4H7BrO/c1-2-4(6)3-5/h2-3H2,1H3 |
| Numero CAS |
816-40-0 |
| EINECS |
212-431-3 |
| Struttura molecolare |
|
| Densità |
1.439g/cm3 |
| Punto di ebollizione |
155.9°C at 760 mmHg |
| Indice di rifrazione |
1.452 |
| Punto d'infiammabilità |
68.3°C |
| Pressione di vapore |
2.96mmHg at 25°C |
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|