728-87-0 4,4'-Dimethoxybenzhydrol
| Nome del prodotto |
4,4'-Dimethoxybenzhydrol |
| Nome inglese |
4,4'-Dimethoxybenzhydrol; Bis(4-methoxyphenyl) carbinol; 4,4-Dimethoxydiphenylmethanol; 4,4-Dimethoxybenzhydrol; Bis(4-methoxyphenyl)carbinol; bis(4-methoxyphenyl)methanol |
| Formula molecolare |
C15H16O3 |
| Peso Molecolare |
244.2857 |
| InChI |
InChI=1/C15H16O3/c1-17-13-7-3-11(4-8-13)15(16)12-5-9-14(18-2)10-6-12/h3-10,15-16H,1-2H3 |
| Numero CAS |
728-87-0 |
| EINECS |
211-975-9 |
| Struttura molecolare |
|
| Densità |
1.135g/cm3 |
| Punto di fusione |
68-72℃ |
| Punto di ebollizione |
406.5°C at 760 mmHg |
| Indice di rifrazione |
1.568 |
| Punto d'infiammabilità |
199.6°C |
| Pressione di vapore |
2.46E-07mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|